C28H24F9PS2 — CID 162329267
(4-phenylsulfanylphenyl)-(4-propan-2-ylphenyl)-[4-(trifluoromethyl)phenyl]sulfanium hexafluorophosphate (PubChem CID 162329267) has the molecular formula C28H24F9PS2 and a molecular weight of 626.59 g/mol. Its IUPAC name is (4-phenylsulfanylphenyl)-(4-propan-2-ylphenyl)-[4-(trifluoromethyl)phenyl]sulfanium hexafluorophosphate.
| Compound Name | (4-phenylsulfanylphenyl)-(4-propan-2-ylphenyl)-[4-(trifluoromethyl)phenyl]sulfanium hexafluorophosphate |
|---|---|
| PubChem CID | 162329267 |
| Molecular Formula | C28H24F9PS2 |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | (4-phenylsulfanylphenyl)-(4-propan-2-ylphenyl)-[4-(trifluoromethyl)phenyl]sulfanium hexafluorophosphate |
| SMILES | CC(C)c1ccc([S+](c2ccc(Sc3ccccc3)cc2)c2ccc(C(F)(F)F)cc2)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C28H24F3S2.F6P/c1-20(2)21-8-14-25(15-9-21)33(26-16-10-22(11-17-26)28(29,30)31)27-18-12-24(13-19-27)32-23-6-4-3-5-7-23;1-7(2,3,4,5)6/h3-20H,1-2H3;/q+1;-1 |
| InChIKey | WECCOAVIQAPPBH-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|