C33H19F24PS2 — CID 25068654
CID 25068654 (PubChem CID 25068654) has the molecular formula C33H19F24PS2 and a molecular weight of 966.57 g/mol.
| Compound Name | CID 25068654 |
|---|---|
| PubChem CID | 25068654 |
| Molecular Formula | C33H19F24PS2 |
| Molecular Weight | 966.57 g/mol |
| Exact Mass | 966.03 |
| IUPAC Name | — |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)[P-](F)(F)(F)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc(Sc2ccc([S+](c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H19S2.C9F24P/c1-4-10-20(11-5-1)25-21-16-18-24(19-17-21)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23;10-1(11,4(16,17)18)7(25,26)34(31,32,33,8(27,28)2(12,13)5(19,20)21)9(29,30)3(14,15)6(22,23)24/h1-19H;/q+1;-1 |
| InChIKey | VERFGDVEZCXTBO-UHFFFAOYSA-N |
| XLogP | 16.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.57 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|