C60H27BF20S4 — CID 159347520
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(4-phenylsulfanylphenyl)sulfanium (PubChem CID 159347520) has the molecular formula C60H27BF20S4 and a molecular weight of 1266.92 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(4-phenylsulfanylphenyl)sulfanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(4-phenylsulfanylphenyl)sulfanium |
|---|---|
| PubChem CID | 159347520 |
| Molecular Formula | C60H27BF20S4 |
| Molecular Weight | 1266.92 g/mol |
| Exact Mass | 1266.08 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(4-phenylsulfanylphenyl)sulfanium |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc(Sc2ccc([S+](c3ccc(Sc4ccccc4)cc3)c3ccc(Sc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H27S4.C24BF20/c1-4-10-28(11-5-1)37-31-16-22-34(23-17-31)40(35-24-18-32(19-25-35)38-29-12-6-2-7-13-29)36-26-20-33(21-27-36)39-30-14-8-3-9-15-30;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h1-27H;/q+1;-1 |
| InChIKey | LGXLCDUYTZDWRD-UHFFFAOYSA-N |
| XLogP | 17.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1266.92 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|