C36H11BF20S2 — CID 175965392
(2-deuterio-4-phenylsulfanylphenyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 175965392) has the molecular formula C36H11BF20S2 and a molecular weight of 899.40 g/mol. Its IUPAC name is (2-deuterio-4-phenylsulfanylphenyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (2-deuterio-4-phenylsulfanylphenyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 175965392 |
| Molecular Formula | C36H11BF20S2 |
| Molecular Weight | 899.40 g/mol |
| Exact Mass | 899.01 |
| IUPAC Name | (2-deuterio-4-phenylsulfanylphenyl)sulfanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[2H]c1cc(Sc2ccccc2)ccc1[SH2+] |
| InChI | InChI=1S/C24BF20.C12H10S2/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h;1-9,13H/q-1;/p+1/i;6D |
| InChIKey | LNNFHZPZFZUJPG-VKNUZHCTSA-O |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.40 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|