C25H26F3NO3S — CID 87189985
3-[4-[N-hydroxy-C-[2-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]carbonimidoyl]-2-methylphenyl]propanoic acid (PubChem CID 87189985) has the molecular formula C25H26F3NO3S and a molecular weight of 477.55 g/mol. Its IUPAC name is 3-[4-[N-hydroxy-C-[2-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]carbonimidoyl]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[N-hydroxy-C-[2-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]carbonimidoyl]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 87189985 |
| Molecular Formula | C25H26F3NO3S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 3-[4-[N-hydroxy-C-[2-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]carbonimidoyl]-2-methylphenyl]propanoic acid |
| SMILES | Cc1cc(C(CCc2sc3cc(C(F)(F)F)ccc3c2C(C)C)=NO)ccc1CCC(=O)O |
| InChI | InChI=1S/C25H26F3NO3S/c1-14(2)24-19-8-7-18(25(26,27)28)13-22(19)33-21(24)10-9-20(29-32)17-5-4-16(15(3)12-17)6-11-23(30)31/h4-5,7-8,12-14,32H,6,9-11H2,1-3H3,(H,30,31) |
| InChIKey | RDTZROKYQBDTKY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|