C26H28F3NO4S — CID 86652871
ethyl 2-[4-[N-hydroxy-C-[2-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]carbonimidoyl]-2-methylphenoxy]acetate (PubChem CID 86652871) has the molecular formula C26H28F3NO4S and a molecular weight of 507.57 g/mol. Its IUPAC name is ethyl 2-[4-[N-hydroxy-C-[2-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]carbonimidoyl]-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[N-hydroxy-C-[2-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]carbonimidoyl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 86652871 |
| Molecular Formula | C26H28F3NO4S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | ethyl 2-[4-[N-hydroxy-C-[2-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]ethyl]carbonimidoyl]-2-methylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(CCc2sc3cc(C(F)(F)F)ccc3c2C(C)C)=NO)cc1C |
| InChI | InChI=1S/C26H28F3NO4S/c1-5-33-24(31)14-34-21-10-6-17(12-16(21)4)20(30-32)9-11-22-25(15(2)3)19-8-7-18(26(27,28)29)13-23(19)35-22/h6-8,10,12-13,15,32H,5,9,11,14H2,1-4H3 |
| InChIKey | NSIJLGYXDBCZOG-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|