C30H34N2O4 — CID 72945957
2-[4-[(Z)-C-benzyl-N-[(4-methoxyphenyl)methoxy]carbonimidoyl]-2-methylphenoxy]-1-piperidin-1-ylethanone (PubChem CID 72945957) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-[4-[(Z)-C-benzyl-N-[(4-methoxyphenyl)methoxy]carbonimidoyl]-2-methylphenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-[(Z)-C-benzyl-N-[(4-methoxyphenyl)methoxy]carbonimidoyl]-2-methylphenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 72945957 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 2-[4-[(Z)-C-benzyl-N-[(4-methoxyphenyl)methoxy]carbonimidoyl]-2-methylphenoxy]-1-piperidin-1-ylethanone |
| SMILES | COc1ccc(CO/N=C(/Cc2ccccc2)c2ccc(OCC(=O)N3CCCCC3)c(C)c2)cc1 |
| InChI | InChI=1S/C30H34N2O4/c1-23-19-26(13-16-29(23)35-22-30(33)32-17-7-4-8-18-32)28(20-24-9-5-3-6-10-24)31-36-21-25-11-14-27(34-2)15-12-25/h3,5-6,9-16,19H,4,7-8,17-18,20-22H2,1-2H3/b31-28- |
| InChIKey | GERCOIGECUHUCS-PNOGMODKSA-N |
| XLogP | 5.56 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|