C25H28F3N3O3 — CID 72694922
1-(4-methylpiperazin-1-yl)-2-[[(5E)-5-[[4-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]oxy]ethanone (PubChem CID 72694922) has the molecular formula C25H28F3N3O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2-[[(5E)-5-[[4-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]oxy]ethanone.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2-[[(5E)-5-[[4-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]oxy]ethanone |
|---|---|
| PubChem CID | 72694922 |
| Molecular Formula | C25H28F3N3O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2-[[(5E)-5-[[4-(trifluoromethyl)phenyl]methoxyimino]-7,8-dihydro-6H-naphthalen-2-yl]oxy]ethanone |
| SMILES | CN1CCN(C(=O)COc2ccc3c(c2)CCC/C3=N\OCc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H28F3N3O3/c1-30-11-13-31(14-12-30)24(32)17-33-21-9-10-22-19(15-21)3-2-4-23(22)29-34-16-18-5-7-20(8-6-18)25(26,27)28/h5-10,15H,2-4,11-14,16-17H2,1H3/b29-23+ |
| InChIKey | LSFAVCIPRYCPQV-BYNJWEBRSA-N |
| XLogP | 4.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|