C22H23F3N2O3 — CID 90021284
N-cyclopropyl-2-[4-[3-[[4-(trifluoromethyl)phenyl]methoxyimino]propyl]phenoxy]acetamide (PubChem CID 90021284) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[3-[[4-(trifluoromethyl)phenyl]methoxyimino]propyl]phenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[3-[[4-(trifluoromethyl)phenyl]methoxyimino]propyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 90021284 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-cyclopropyl-2-[4-[3-[[4-(trifluoromethyl)phenyl]methoxyimino]propyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(CCC=NOCc2ccc(C(F)(F)F)cc2)cc1)NC1CC1 |
| InChI | InChI=1S/C22H23F3N2O3/c23-22(24,25)18-7-3-17(4-8-18)14-30-26-13-1-2-16-5-11-20(12-6-16)29-15-21(28)27-19-9-10-19/h3-8,11-13,19H,1-2,9-10,14-15H2,(H,27,28) |
| InChIKey | JWJQKXHJMTVCEE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|