C20H20F3NO5 — CID 118238913
methyl 2-hydroxy-3-[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]propanoate (PubChem CID 118238913) has the molecular formula C20H20F3NO5 and a molecular weight of 411.38 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]propanoate.
| Compound Name | methyl 2-hydroxy-3-[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 118238913 |
| Molecular Formula | C20H20F3NO5 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | methyl 2-hydroxy-3-[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]propanoate |
| SMILES | COC(=O)C(O)COc1ccc(CC=NOCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H20F3NO5/c1-27-19(26)18(25)13-28-17-8-4-14(5-9-17)10-11-24-29-12-15-2-6-16(7-3-15)20(21,22)23/h2-9,11,18,25H,10,12-13H2,1H3 |
| InChIKey | BIEQTSUIFARWMZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|