C23H22F3NO5 — CID 118239005
4-hydroxy-5,5-dimethyl-3-[[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]methyl]furan-2-one (PubChem CID 118239005) has the molecular formula C23H22F3NO5 and a molecular weight of 449.43 g/mol. Its IUPAC name is 4-hydroxy-5,5-dimethyl-3-[[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]methyl]furan-2-one.
| Compound Name | 4-hydroxy-5,5-dimethyl-3-[[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]methyl]furan-2-one |
|---|---|
| PubChem CID | 118239005 |
| Molecular Formula | C23H22F3NO5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 4-hydroxy-5,5-dimethyl-3-[[4-[2-[[4-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenoxy]methyl]furan-2-one |
| SMILES | CC1(C)OC(=O)C(COc2ccc(CC=NOCc3ccc(C(F)(F)F)cc3)cc2)=C1O |
| InChI | InChI=1S/C23H22F3NO5/c1-22(2)20(28)19(21(29)32-22)14-30-18-9-5-15(6-10-18)11-12-27-31-13-16-3-7-17(8-4-16)23(24,25)26/h3-10,12,28H,11,13-14H2,1-2H3 |
| InChIKey | DFQYFKYHKKMNPD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|