C24H26F3N3O5 — CID 140667204
N-(3,4-dihydro-2H-pyran-4-ylmethyl)-2-[4-[C-(methoxymethyl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]carbonimidoyl]phenoxy]acetamide (PubChem CID 140667204) has the molecular formula C24H26F3N3O5 and a molecular weight of 493.48 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-4-ylmethyl)-2-[4-[C-(methoxymethyl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]carbonimidoyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dihydro-2H-pyran-4-ylmethyl)-2-[4-[C-(methoxymethyl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]carbonimidoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 140667204 |
| Molecular Formula | C24H26F3N3O5 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-(3,4-dihydro-2H-pyran-4-ylmethyl)-2-[4-[C-(methoxymethyl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]carbonimidoyl]phenoxy]acetamide |
| SMILES | COCC(=NOCc1ccc(C(F)(F)F)nc1)c1ccc(OCC(=O)NCC2C=COCC2)cc1 |
| InChI | InChI=1S/C24H26F3N3O5/c1-32-15-21(30-35-14-18-2-7-22(28-13-18)24(25,26)27)19-3-5-20(6-4-19)34-16-23(31)29-12-17-8-10-33-11-9-17/h2-8,10,13,17H,9,11-12,14-16H2,1H3,(H,29,31) |
| InChIKey | IIVHHLGFLGCOBJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|