C30H31F3N2O3S — CID 140667203
2-[4-[C-(methoxymethyl)-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]carbonimidoyl]phenoxy]-1-piperidin-1-ylethanethione (PubChem CID 140667203) has the molecular formula C30H31F3N2O3S and a molecular weight of 556.65 g/mol. Its IUPAC name is 2-[4-[C-(methoxymethyl)-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]carbonimidoyl]phenoxy]-1-piperidin-1-ylethanethione.
| Compound Name | 2-[4-[C-(methoxymethyl)-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]carbonimidoyl]phenoxy]-1-piperidin-1-ylethanethione |
|---|---|
| PubChem CID | 140667203 |
| Molecular Formula | C30H31F3N2O3S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 2-[4-[C-(methoxymethyl)-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]carbonimidoyl]phenoxy]-1-piperidin-1-ylethanethione |
| SMILES | COCC(=NOCc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(OCC(=S)N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H31F3N2O3S/c1-36-20-28(25-11-15-27(16-12-25)37-21-29(39)35-17-3-2-4-18-35)34-38-19-22-5-7-23(8-6-22)24-9-13-26(14-10-24)30(31,32)33/h5-16H,2-4,17-21H2,1H3 |
| InChIKey | SSMQYEMWMFUWLH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|