C20H21F3N2O3 — CID 86859322
N-[(2-morpholin-4-ylphenyl)methyl]-2-[4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 86859322) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[(2-morpholin-4-ylphenyl)methyl]-2-[4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(2-morpholin-4-ylphenyl)methyl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 86859322 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[(2-morpholin-4-ylphenyl)methyl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1)NCc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C20H21F3N2O3/c21-20(22,23)16-5-7-17(8-6-16)28-14-19(26)24-13-15-3-1-2-4-18(15)25-9-11-27-12-10-25/h1-8H,9-14H2,(H,24,26) |
| InChIKey | XDEVRVZWAZUANA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |