C20H19NO6 — CID 71664178
[5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] N-ethyl-N-methylcarbamate (PubChem CID 71664178) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] N-ethyl-N-methylcarbamate.
| Compound Name | [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 71664178 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [5-hydroxy-3-(4-methoxyphenyl)-4-oxochromen-7-yl] N-ethyl-N-methylcarbamate |
| SMILES | CCN(C)C(=O)Oc1cc(O)c2c(=O)c(-c3ccc(OC)cc3)coc2c1 |
| InChI | InChI=1S/C20H19NO6/c1-4-21(2)20(24)27-14-9-16(22)18-17(10-14)26-11-15(19(18)23)12-5-7-13(25-3)8-6-12/h5-11,22H,4H2,1-3H3 |
| InChIKey | VCGMJAQDSVMONB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |