C30H40O10 — CID 22696566
5-hydroxy-7-octoxy-3-[4-[2,3,4-trihydroxy-1-(2-hydroxyethoxy)pentoxy]phenyl]chromen-4-one (PubChem CID 22696566) has the molecular formula C30H40O10 and a molecular weight of 560.64 g/mol. Its IUPAC name is 5-hydroxy-7-octoxy-3-[4-[2,3,4-trihydroxy-1-(2-hydroxyethoxy)pentoxy]phenyl]chromen-4-one.
| Compound Name | 5-hydroxy-7-octoxy-3-[4-[2,3,4-trihydroxy-1-(2-hydroxyethoxy)pentoxy]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 22696566 |
| Molecular Formula | C30H40O10 |
| Molecular Weight | 560.64 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 5-hydroxy-7-octoxy-3-[4-[2,3,4-trihydroxy-1-(2-hydroxyethoxy)pentoxy]phenyl]chromen-4-one |
| SMILES | CCCCCCCCOc1cc(O)c2c(=O)c(-c3ccc(OC(OCCO)C(O)C(O)C(C)O)cc3)coc2c1 |
| InChI | InChI=1S/C30H40O10/c1-3-4-5-6-7-8-14-37-22-16-24(33)26-25(17-22)39-18-23(28(26)35)20-9-11-21(12-10-20)40-30(38-15-13-31)29(36)27(34)19(2)32/h9-12,16-19,27,29-34,36H,3-8,13-15H2,1-2H3 |
| InChIKey | DYCDYVLFYPIJCK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|