C33H40O6 — CID 122362406
3,6-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,7-dihydroxyxanthen-9-one (PubChem CID 122362406) has the molecular formula C33H40O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,7-dihydroxyxanthen-9-one.
| Compound Name | 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,7-dihydroxyxanthen-9-one |
|---|---|
| PubChem CID | 122362406 |
| Molecular Formula | C33H40O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 3,6-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,7-dihydroxyxanthen-9-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1cc(O)c2c(=O)c3cc(O)c(OC/C=C(\C)CCC=C(C)C)cc3oc2c1 |
| InChI | InChI=1S/C33H40O6/c1-21(2)9-7-11-23(5)13-15-37-25-17-28(35)32-31(18-25)39-29-20-30(27(34)19-26(29)33(32)36)38-16-14-24(6)12-8-10-22(3)4/h9-10,13-14,17-20,34-35H,7-8,11-12,15-16H2,1-6H3/b23-13+,24-14+ |
| InChIKey | AWBDGBJWLQMJRQ-RNIAWFEPSA-N |
| XLogP | 8.50 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|