C21H25ClO3 — CID 3338256
6-chloro-7-(3,7-dimethylocta-2,6-dienoxy)-4-ethylchromen-2-one (PubChem CID 3338256) has the molecular formula C21H25ClO3 and a molecular weight of 360.88 g/mol. Its IUPAC name is 6-chloro-7-(3,7-dimethylocta-2,6-dienoxy)-4-ethylchromen-2-one.
| Compound Name | 6-chloro-7-(3,7-dimethylocta-2,6-dienoxy)-4-ethylchromen-2-one |
|---|---|
| PubChem CID | 3338256 |
| Molecular Formula | C21H25ClO3 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 6-chloro-7-(3,7-dimethylocta-2,6-dienoxy)-4-ethylchromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OCC=C(C)CCC=C(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C21H25ClO3/c1-5-16-11-21(23)25-19-13-20(18(22)12-17(16)19)24-10-9-15(4)8-6-7-14(2)3/h7,9,11-13H,5-6,8,10H2,1-4H3 |
| InChIKey | PQECBVKUBWAOII-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|