C53H60N6O6 — CID 71599464
[4-[(E)-2-[3,5-bis[(4-benzyl-1,4-diazepane-1-carbonyl)oxy]phenyl]ethenyl]phenyl] 4-benzyl-1,4-diazepane-1-carboxylate (PubChem CID 71599464) has the molecular formula C53H60N6O6 and a molecular weight of 877.10 g/mol. Its IUPAC name is [4-[(E)-2-[3,5-bis[(4-benzyl-1,4-diazepane-1-carbonyl)oxy]phenyl]ethenyl]phenyl] 4-benzyl-1,4-diazepane-1-carboxylate.
| Compound Name | [4-[(E)-2-[3,5-bis[(4-benzyl-1,4-diazepane-1-carbonyl)oxy]phenyl]ethenyl]phenyl] 4-benzyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 71599464 |
| Molecular Formula | C53H60N6O6 |
| Molecular Weight | 877.10 g/mol |
| Exact Mass | 876.46 |
| IUPAC Name | [4-[(E)-2-[3,5-bis[(4-benzyl-1,4-diazepane-1-carbonyl)oxy]phenyl]ethenyl]phenyl] 4-benzyl-1,4-diazepane-1-carboxylate |
| SMILES | O=C(Oc1ccc(/C=C/c2cc(OC(=O)N3CCCN(Cc4ccccc4)CC3)cc(OC(=O)N3CCCN(Cc4ccccc4)CC3)c2)cc1)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C53H60N6O6/c60-51(57-28-10-25-54(31-34-57)40-44-13-4-1-5-14-44)63-48-23-21-43(22-24-48)19-20-47-37-49(64-52(61)58-29-11-26-55(32-35-58)41-45-15-6-2-7-16-45)39-50(38-47)65-53(62)59-30-12-27-56(33-36-59)42-46-17-8-3-9-18-46/h1-9,13-24,37-39H,10-12,25-36,40-42H2/b20-19+ |
| InChIKey | ZISYMQVWLDDVRI-FMQUCBEESA-N |
| XLogP | 8.98 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.10 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|