C29H38ClN3O3 — CID 25065250
2-[4-[5-[[3-(4-chlorophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]-N-(2-methylpropyl)acetamide (PubChem CID 25065250) has the molecular formula C29H38ClN3O3 and a molecular weight of 512.09 g/mol. Its IUPAC name is 2-[4-[5-[[3-(4-chlorophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[4-[5-[[3-(4-chlorophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 25065250 |
| Molecular Formula | C29H38ClN3O3 |
| Molecular Weight | 512.09 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 2-[4-[5-[[3-(4-chlorophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CN1CCN(CCCCCOc2ccc3c(-c4ccc(Cl)cc4)coc3c2)CC1 |
| InChI | InChI=1S/C29H38ClN3O3/c1-22(2)19-31-29(34)20-33-15-13-32(14-16-33)12-4-3-5-17-35-25-10-11-26-27(21-36-28(26)18-25)23-6-8-24(30)9-7-23/h6-11,18,21-22H,3-5,12-17,19-20H2,1-2H3,(H,31,34) |
| InChIKey | FUTFHJZYNPILFI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.09 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|