C26H35N3O3S — CID 25064207
N-propan-2-yl-2-[4-[5-[(3-thiophen-2-yl-1-benzofuran-6-yl)oxy]pentyl]piperazin-1-yl]acetamide (PubChem CID 25064207) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is N-propan-2-yl-2-[4-[5-[(3-thiophen-2-yl-1-benzofuran-6-yl)oxy]pentyl]piperazin-1-yl]acetamide.
| Compound Name | N-propan-2-yl-2-[4-[5-[(3-thiophen-2-yl-1-benzofuran-6-yl)oxy]pentyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 25064207 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-propan-2-yl-2-[4-[5-[(3-thiophen-2-yl-1-benzofuran-6-yl)oxy]pentyl]piperazin-1-yl]acetamide |
| SMILES | CC(C)NC(=O)CN1CCN(CCCCCOc2ccc3c(-c4cccs4)coc3c2)CC1 |
| InChI | InChI=1S/C26H35N3O3S/c1-20(2)27-26(30)18-29-13-11-28(12-14-29)10-4-3-5-15-31-21-8-9-22-23(19-32-24(22)17-21)25-7-6-16-33-25/h6-9,16-17,19-20H,3-5,10-15,18H2,1-2H3,(H,27,30) |
| InChIKey | JMPJNYWWAZPIDW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|