C29H36N4O3 — CID 25064630
2-[4-[5-[[3-(4-cyanophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 25064630) has the molecular formula C29H36N4O3 and a molecular weight of 488.63 g/mol. Its IUPAC name is 2-[4-[5-[[3-(4-cyanophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[5-[[3-(4-cyanophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 25064630 |
| Molecular Formula | C29H36N4O3 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-[4-[5-[[3-(4-cyanophenyl)-1-benzofuran-6-yl]oxy]pentyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCN(CCCCCOc2ccc3c(-c4ccc(C#N)cc4)coc3c2)CC1 |
| InChI | InChI=1S/C29H36N4O3/c1-22(2)31-29(34)20-33-15-13-32(14-16-33)12-4-3-5-17-35-25-10-11-26-27(21-36-28(26)18-25)24-8-6-23(19-30)7-9-24/h6-11,18,21-22H,3-5,12-17,20H2,1-2H3,(H,31,34) |
| InChIKey | ZHCIVDZVJBHMJH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|