C33H32N6O4 — CID 175668200
4-[4-[[1-[3-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxypropyl]triazol-4-yl]methyl]piperazin-1-yl]benzonitrile (PubChem CID 175668200) has the molecular formula C33H32N6O4 and a molecular weight of 576.66 g/mol. Its IUPAC name is 4-[4-[[1-[3-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxypropyl]triazol-4-yl]methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-[[1-[3-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxypropyl]triazol-4-yl]methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 175668200 |
| Molecular Formula | C33H32N6O4 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 4-[4-[[1-[3-[3-(4-methoxyphenyl)-4-oxochromen-7-yl]oxypropyl]triazol-4-yl]methyl]piperazin-1-yl]benzonitrile |
| SMILES | COc1ccc(-c2coc3cc(OCCCn4cc(CN5CCN(c6ccc(C#N)cc6)CC5)nn4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C33H32N6O4/c1-41-28-9-5-25(6-10-28)31-23-43-32-19-29(11-12-30(32)33(31)40)42-18-2-13-39-22-26(35-36-39)21-37-14-16-38(17-15-37)27-7-3-24(20-34)4-8-27/h3-12,19,22-23H,2,13-18,21H2,1H3 |
| InChIKey | GZIVCNYXWSZQAE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 109.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|