C32H32ClN5O4 — CID 175668198
7-[3-[4-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]triazol-1-yl]propoxy]-3-(4-methoxyphenyl)chromen-4-one (PubChem CID 175668198) has the molecular formula C32H32ClN5O4 and a molecular weight of 586.09 g/mol. Its IUPAC name is 7-[3-[4-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]triazol-1-yl]propoxy]-3-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 7-[3-[4-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]triazol-1-yl]propoxy]-3-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 175668198 |
| Molecular Formula | C32H32ClN5O4 |
| Molecular Weight | 586.09 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 7-[3-[4-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]triazol-1-yl]propoxy]-3-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2coc3cc(OCCCn4cc(CN5CCN(c6cccc(Cl)c6)CC5)nn4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C32H32ClN5O4/c1-40-27-8-6-23(7-9-27)30-22-42-31-19-28(10-11-29(31)32(30)39)41-17-3-12-38-21-25(34-35-38)20-36-13-15-37(16-14-36)26-5-2-4-24(33)18-26/h2,4-11,18-19,21-22H,3,12-17,20H2,1H3 |
| InChIKey | LASXVQSMDIUBRH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 85.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.09 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|