C28H37ClN4O2 — CID 25007091
2-[4-[6-[1-(4-chlorophenyl)indol-5-yl]oxyhexyl]piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 25007091) has the molecular formula C28H37ClN4O2 and a molecular weight of 497.08 g/mol. Its IUPAC name is 2-[4-[6-[1-(4-chlorophenyl)indol-5-yl]oxyhexyl]piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[6-[1-(4-chlorophenyl)indol-5-yl]oxyhexyl]piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 25007091 |
| Molecular Formula | C28H37ClN4O2 |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 2-[4-[6-[1-(4-chlorophenyl)indol-5-yl]oxyhexyl]piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(CCCCCCOc2ccc3c(ccn3-c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C28H37ClN4O2/c1-30(2)28(34)22-32-18-16-31(17-19-32)14-5-3-4-6-20-35-26-11-12-27-23(21-26)13-15-33(27)25-9-7-24(29)8-10-25/h7-13,15,21H,3-6,14,16-20,22H2,1-2H3 |
| InChIKey | PMJMMVBSJWXWJW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 40.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|