C28H38ClN3O2 — CID 24994624
(4-chlorophenyl)-[4-[5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]pentoxy]phenyl]methanone (PubChem CID 24994624) has the molecular formula C28H38ClN3O2 and a molecular weight of 484.08 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-[5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]pentoxy]phenyl]methanone.
| Compound Name | (4-chlorophenyl)-[4-[5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]pentoxy]phenyl]methanone |
|---|---|
| PubChem CID | 24994624 |
| Molecular Formula | C28H38ClN3O2 |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (4-chlorophenyl)-[4-[5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]pentoxy]phenyl]methanone |
| SMILES | CN1CCC(N2CCN(CCCCCOc3ccc(C(=O)c4ccc(Cl)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H38ClN3O2/c1-30-16-13-26(14-17-30)32-20-18-31(19-21-32)15-3-2-4-22-34-27-11-7-24(8-12-27)28(33)23-5-9-25(29)10-6-23/h5-12,26H,2-4,13-22H2,1H3 |
| InChIKey | VVEXKHBVXWKRLS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|