C20H27N3O3 — CID 78792851
N-(furan-2-ylmethyl)-N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide (PubChem CID 78792851) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 78792851 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-2-[4-(2-phenoxyethyl)piperazin-1-yl]acetamide |
| SMILES | CN(Cc1ccco1)C(=O)CN1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C20H27N3O3/c1-21(16-19-8-5-14-25-19)20(24)17-23-11-9-22(10-12-23)13-15-26-18-6-3-2-4-7-18/h2-8,14H,9-13,15-17H2,1H3 |
| InChIKey | OJYCLUMNFUBWLL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |