C16H26N4O5S — CID 47023476
N-(furan-2-ylmethyl)-N-methyl-2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 47023476) has the molecular formula C16H26N4O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 47023476 |
| Molecular Formula | C16H26N4O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-2-(4-morpholin-4-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CN(Cc1ccco1)C(=O)CN1CCN(S(=O)(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C16H26N4O5S/c1-17(13-15-3-2-10-25-15)16(21)14-18-4-6-19(7-5-18)26(22,23)20-8-11-24-12-9-20/h2-3,10H,4-9,11-14H2,1H3 |
| InChIKey | KHKCDYMJJDXYQK-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 86.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |