C14H23N3O4S — CID 27128819
N-methyl-N-[(5-methylfuran-2-yl)methyl]-2-(4-methylsulfonylpiperazin-1-yl)acetamide (PubChem CID 27128819) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-methyl-N-[(5-methylfuran-2-yl)methyl]-2-(4-methylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-methyl-N-[(5-methylfuran-2-yl)methyl]-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 27128819 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-methyl-N-[(5-methylfuran-2-yl)methyl]-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
| SMILES | Cc1ccc(CN(C)C(=O)CN2CCN(S(C)(=O)=O)CC2)o1 |
| InChI | InChI=1S/C14H23N3O4S/c1-12-4-5-13(21-12)10-15(2)14(18)11-16-6-8-17(9-7-16)22(3,19)20/h4-5H,6-11H2,1-3H3 |
| InChIKey | GLQPAUAKXRZZBP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |