C19H25N3O4S — CID 8692545
2-[4-(benzenesulfonyl)piperazin-1-yl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 8692545) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 8692545 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(C)C(=O)CN2CCN(S(=O)(=O)c3ccccc3)CC2)o1 |
| InChI | InChI=1S/C19H25N3O4S/c1-16-8-9-17(26-16)14-20(2)19(23)15-21-10-12-22(13-11-21)27(24,25)18-6-4-3-5-7-18/h3-9H,10-15H2,1-2H3 |
| InChIKey | NQAZNXLQCHEPOP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |