C16H25BrClN3O — CID 119925366
2-[3-(1-aminoethyl)piperidin-1-yl]-N-(4-bromo-2-methylphenyl)acetamide;hydrochloride (PubChem CID 119925366) has the molecular formula C16H25BrClN3O and a molecular weight of 390.75 g/mol. Its IUPAC name is 2-[3-(1-aminoethyl)piperidin-1-yl]-N-(4-bromo-2-methylphenyl)acetamide;hydrochloride.
| Compound Name | 2-[3-(1-aminoethyl)piperidin-1-yl]-N-(4-bromo-2-methylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119925366 |
| Molecular Formula | C16H25BrClN3O |
| Molecular Weight | 390.75 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-[3-(1-aminoethyl)piperidin-1-yl]-N-(4-bromo-2-methylphenyl)acetamide;hydrochloride |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN1CCCC(C(C)N)C1.Cl |
| InChI | InChI=1S/C16H24BrN3O.ClH/c1-11-8-14(17)5-6-15(11)19-16(21)10-20-7-3-4-13(9-20)12(2)18;/h5-6,8,12-13H,3-4,7,9-10,18H2,1-2H3,(H,19,21);1H |
| InChIKey | XFPNBQWXLOSYPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.75 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |