C20H25N3O — CID 23905235
1-(1-benzylpyrrolidin-3-yl)-3-(2,4-dimethylphenyl)urea (PubChem CID 23905235) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(1-benzylpyrrolidin-3-yl)-3-(2,4-dimethylphenyl)urea.
| Compound Name | 1-(1-benzylpyrrolidin-3-yl)-3-(2,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 23905235 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-(1-benzylpyrrolidin-3-yl)-3-(2,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC2CCN(Cc3ccccc3)C2)c(C)c1 |
| InChI | InChI=1S/C20H25N3O/c1-15-8-9-19(16(2)12-15)22-20(24)21-18-10-11-23(14-18)13-17-6-4-3-5-7-17/h3-9,12,18H,10-11,13-14H2,1-2H3,(H2,21,22,24) |
| InChIKey | NQQMEDPCJDXFCB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |