C27H25ClN2O2 — CID 10003619
6-chloro-4-[[1-[(4-phenylphenyl)methyl]piperidin-4-yl]amino]chromen-2-one (PubChem CID 10003619) has the molecular formula C27H25ClN2O2 and a molecular weight of 444.96 g/mol. Its IUPAC name is 6-chloro-4-[[1-[(4-phenylphenyl)methyl]piperidin-4-yl]amino]chromen-2-one.
| Compound Name | 6-chloro-4-[[1-[(4-phenylphenyl)methyl]piperidin-4-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 10003619 |
| Molecular Formula | C27H25ClN2O2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 6-chloro-4-[[1-[(4-phenylphenyl)methyl]piperidin-4-yl]amino]chromen-2-one |
| SMILES | O=c1cc(NC2CCN(Cc3ccc(-c4ccccc4)cc3)CC2)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C27H25ClN2O2/c28-22-10-11-26-24(16-22)25(17-27(31)32-26)29-23-12-14-30(15-13-23)18-19-6-8-21(9-7-19)20-4-2-1-3-5-20/h1-11,16-17,23,29H,12-15,18H2 |
| InChIKey | GUAPROIQHBZTPK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|