C21H21ClN2O4 — CID 87096405
6-chloro-4-[[1-[(3,4-dihydroxyphenyl)methyl]piperidin-4-yl]amino]chromen-2-one (PubChem CID 87096405) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is 6-chloro-4-[[1-[(3,4-dihydroxyphenyl)methyl]piperidin-4-yl]amino]chromen-2-one.
| Compound Name | 6-chloro-4-[[1-[(3,4-dihydroxyphenyl)methyl]piperidin-4-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 87096405 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 6-chloro-4-[[1-[(3,4-dihydroxyphenyl)methyl]piperidin-4-yl]amino]chromen-2-one |
| SMILES | O=c1cc(NC2CCN(Cc3ccc(O)c(O)c3)CC2)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C21H21ClN2O4/c22-14-2-4-20-16(10-14)17(11-21(27)28-20)23-15-5-7-24(8-6-15)12-13-1-3-18(25)19(26)9-13/h1-4,9-11,15,23,25-26H,5-8,12H2 |
| InChIKey | XRXDWJWUESOOGA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|