C24H25ClN2O2 — CID 20817848
6-chloro-7-methyl-4-[[1-[(E)-3-phenylprop-2-enyl]piperidin-4-yl]amino]chromen-2-one (PubChem CID 20817848) has the molecular formula C24H25ClN2O2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 6-chloro-7-methyl-4-[[1-[(E)-3-phenylprop-2-enyl]piperidin-4-yl]amino]chromen-2-one.
| Compound Name | 6-chloro-7-methyl-4-[[1-[(E)-3-phenylprop-2-enyl]piperidin-4-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 20817848 |
| Molecular Formula | C24H25ClN2O2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 6-chloro-7-methyl-4-[[1-[(E)-3-phenylprop-2-enyl]piperidin-4-yl]amino]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(NC3CCN(C/C=C/c4ccccc4)CC3)c2cc1Cl |
| InChI | InChI=1S/C24H25ClN2O2/c1-17-14-23-20(15-21(17)25)22(16-24(28)29-23)26-19-9-12-27(13-10-19)11-5-8-18-6-3-2-4-7-18/h2-8,14-16,19,26H,9-13H2,1H3/b8-5+ |
| InChIKey | ZHDMDQFXHFHCSM-VMPITWQZSA-N |
| XLogP | 5.34 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|