C24H28N2O3 — CID 10249946
4-[[1-[(2,4-dimethylphenyl)methyl]piperidin-4-yl]amino]-6-methoxychromen-2-one (PubChem CID 10249946) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[[1-[(2,4-dimethylphenyl)methyl]piperidin-4-yl]amino]-6-methoxychromen-2-one.
| Compound Name | 4-[[1-[(2,4-dimethylphenyl)methyl]piperidin-4-yl]amino]-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 10249946 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 4-[[1-[(2,4-dimethylphenyl)methyl]piperidin-4-yl]amino]-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)cc(NC3CCN(Cc4ccc(C)cc4C)CC3)c2c1 |
| InChI | InChI=1S/C24H28N2O3/c1-16-4-5-18(17(2)12-16)15-26-10-8-19(9-11-26)25-22-14-24(27)29-23-7-6-20(28-3)13-21(22)23/h4-7,12-14,19,25H,8-11,15H2,1-3H3 |
| InChIKey | ZFKBKRPCKFHQJJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|