C24H24N2O3S — CID 22348235
4-[[1-(1-benzothiophen-4-ylmethyl)piperidin-4-yl]amino]-6-methoxychromen-2-one (PubChem CID 22348235) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-[[1-(1-benzothiophen-4-ylmethyl)piperidin-4-yl]amino]-6-methoxychromen-2-one.
| Compound Name | 4-[[1-(1-benzothiophen-4-ylmethyl)piperidin-4-yl]amino]-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 22348235 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-[[1-(1-benzothiophen-4-ylmethyl)piperidin-4-yl]amino]-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)cc(NC3CCN(Cc4cccc5sccc45)CC3)c2c1 |
| InChI | InChI=1S/C24H24N2O3S/c1-28-18-5-6-22-20(13-18)21(14-24(27)29-22)25-17-7-10-26(11-8-17)15-16-3-2-4-23-19(16)9-12-30-23/h2-6,9,12-14,17,25H,7-8,10-11,15H2,1H3 |
| InChIKey | ZVRXHCKBGQCBMN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|