C22H19ClF2N2O4 — CID 11612098
6-chloro-4-[[1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]amino]chromen-2-one (PubChem CID 11612098) has the molecular formula C22H19ClF2N2O4 and a molecular weight of 448.85 g/mol. Its IUPAC name is 6-chloro-4-[[1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]amino]chromen-2-one.
| Compound Name | 6-chloro-4-[[1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 11612098 |
| Molecular Formula | C22H19ClF2N2O4 |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 6-chloro-4-[[1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperidin-4-yl]amino]chromen-2-one |
| SMILES | O=c1cc(NC2CCN(Cc3ccc4c(c3)OC(F)(F)O4)CC2)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C22H19ClF2N2O4/c23-14-2-4-18-16(10-14)17(11-21(28)29-18)26-15-5-7-27(8-6-15)12-13-1-3-19-20(9-13)31-22(24,25)30-19/h1-4,9-11,15,26H,5-8,12H2 |
| InChIKey | KSHGPOSCFJFCQM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|