C24H25ClN2O3 — CID 142842590
6-chloro-4-[[1-(2,3-dihydro-1-benzofuran-5-ylmethyl)azepan-4-yl]amino]chromen-2-one (PubChem CID 142842590) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is 6-chloro-4-[[1-(2,3-dihydro-1-benzofuran-5-ylmethyl)azepan-4-yl]amino]chromen-2-one.
| Compound Name | 6-chloro-4-[[1-(2,3-dihydro-1-benzofuran-5-ylmethyl)azepan-4-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 142842590 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 6-chloro-4-[[1-(2,3-dihydro-1-benzofuran-5-ylmethyl)azepan-4-yl]amino]chromen-2-one |
| SMILES | O=c1cc(NC2CCCN(Cc3ccc4c(c3)CCO4)CC2)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C24H25ClN2O3/c25-18-4-6-23-20(13-18)21(14-24(28)30-23)26-19-2-1-9-27(10-7-19)15-16-3-5-22-17(12-16)8-11-29-22/h3-6,12-14,19,26H,1-2,7-11,15H2 |
| InChIKey | VMEXFZHAOGTLMK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|