C29H29F3N2O5 — CID 22348178
6-methoxy-4-[[1-[(7-methylnaphthalen-2-yl)methyl]piperidin-4-yl]amino]chromen-2-one;2,2,2-trifluoroacetic acid (PubChem CID 22348178) has the molecular formula C29H29F3N2O5 and a molecular weight of 542.55 g/mol. Its IUPAC name is 6-methoxy-4-[[1-[(7-methylnaphthalen-2-yl)methyl]piperidin-4-yl]amino]chromen-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-methoxy-4-[[1-[(7-methylnaphthalen-2-yl)methyl]piperidin-4-yl]amino]chromen-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22348178 |
| Molecular Formula | C29H29F3N2O5 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 6-methoxy-4-[[1-[(7-methylnaphthalen-2-yl)methyl]piperidin-4-yl]amino]chromen-2-one;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2oc(=O)cc(NC3CCN(Cc4ccc5ccc(C)cc5c4)CC3)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H28N2O3.C2HF3O2/c1-18-3-5-20-6-4-19(14-21(20)13-18)17-29-11-9-22(10-12-29)28-25-16-27(30)32-26-8-7-23(31-2)15-24(25)26;3-2(4,5)1(6)7/h3-8,13-16,22,28H,9-12,17H2,1-2H3;(H,6,7) |
| InChIKey | JJUJZTUIKYYUFP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|