C30H32N2O2 — CID 142842603
6-(4-methylcyclohexa-1,3-dien-1-yl)-4-[[1-[(E)-3-phenylprop-2-enyl]piperidin-4-yl]amino]chromen-2-one (PubChem CID 142842603) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 6-(4-methylcyclohexa-1,3-dien-1-yl)-4-[[1-[(E)-3-phenylprop-2-enyl]piperidin-4-yl]amino]chromen-2-one.
| Compound Name | 6-(4-methylcyclohexa-1,3-dien-1-yl)-4-[[1-[(E)-3-phenylprop-2-enyl]piperidin-4-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 142842603 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 6-(4-methylcyclohexa-1,3-dien-1-yl)-4-[[1-[(E)-3-phenylprop-2-enyl]piperidin-4-yl]amino]chromen-2-one |
| SMILES | CC1=CC=C(c2ccc3oc(=O)cc(NC4CCN(C/C=C/c5ccccc5)CC4)c3c2)CC1 |
| InChI | InChI=1S/C30H32N2O2/c1-22-9-11-24(12-10-22)25-13-14-29-27(20-25)28(21-30(33)34-29)31-26-15-18-32(19-16-26)17-5-8-23-6-3-2-4-7-23/h2-9,11,13-14,20-21,26,31H,10,12,15-19H2,1H3/b8-5+ |
| InChIKey | RVDGVBFSFMZGLX-VMPITWQZSA-N |
| XLogP | 6.51 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|