C22H31N5O — CID 74376083
1-[2-(dimethylamino)ethyl]-3-[[1-(3-phenylprop-2-enyl)piperidin-4-yl]amino]pyrazin-2-one (PubChem CID 74376083) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[[1-(3-phenylprop-2-enyl)piperidin-4-yl]amino]pyrazin-2-one.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[[1-(3-phenylprop-2-enyl)piperidin-4-yl]amino]pyrazin-2-one |
|---|---|
| PubChem CID | 74376083 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[[1-(3-phenylprop-2-enyl)piperidin-4-yl]amino]pyrazin-2-one |
| SMILES | CN(C)CCn1ccnc(NC2CCN(CC=Cc3ccccc3)CC2)c1=O |
| InChI | InChI=1S/C22H31N5O/c1-25(2)17-18-27-16-12-23-21(22(27)28)24-20-10-14-26(15-11-20)13-6-9-19-7-4-3-5-8-19/h3-9,12,16,20H,10-11,13-15,17-18H2,1-2H3,(H,23,24) |
| InChIKey | JESYMMLFYGMNMJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |