C25H30N4O — CID 59293572
3-[[1-(2,2-diphenylethyl)piperidin-4-yl]amino]-1-ethylpyrazin-2-one (PubChem CID 59293572) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 3-[[1-(2,2-diphenylethyl)piperidin-4-yl]amino]-1-ethylpyrazin-2-one.
| Compound Name | 3-[[1-(2,2-diphenylethyl)piperidin-4-yl]amino]-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 59293572 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 3-[[1-(2,2-diphenylethyl)piperidin-4-yl]amino]-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(NC2CCN(CC(c3ccccc3)c3ccccc3)CC2)c1=O |
| InChI | InChI=1S/C25H30N4O/c1-2-29-18-15-26-24(25(29)30)27-22-13-16-28(17-14-22)19-23(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,15,18,22-23H,2,13-14,16-17,19H2,1H3,(H,26,27) |
| InChIKey | QSFIPEJLVIPCED-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |