C25H29N5O3 — CID 24895862
2-[2-oxo-3-[[1-(2-phenoxyethyl)piperidin-4-yl]amino]pyrazin-1-yl]-N-phenylacetamide (PubChem CID 24895862) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[2-oxo-3-[[1-(2-phenoxyethyl)piperidin-4-yl]amino]pyrazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[2-oxo-3-[[1-(2-phenoxyethyl)piperidin-4-yl]amino]pyrazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 24895862 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-[2-oxo-3-[[1-(2-phenoxyethyl)piperidin-4-yl]amino]pyrazin-1-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1ccnc(NC2CCN(CCOc3ccccc3)CC2)c1=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H29N5O3/c31-23(27-20-7-3-1-4-8-20)19-30-16-13-26-24(25(30)32)28-21-11-14-29(15-12-21)17-18-33-22-9-5-2-6-10-22/h1-10,13,16,21H,11-12,14-15,17-19H2,(H,26,28)(H,27,31) |
| InChIKey | QCZROBLZGOVYFB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |