C22H23N3O3 — CID 42122386
2-benzyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-benzoxazole-5-carboxamide (PubChem CID 42122386) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-benzyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-benzyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 42122386 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-benzyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1ccc2oc(Cc3ccccc3)nc2c1 |
| InChI | InChI=1S/C22H23N3O3/c26-21-8-4-12-25(21)13-5-11-23-22(27)17-9-10-19-18(15-17)24-20(28-19)14-16-6-2-1-3-7-16/h1-3,6-7,9-10,15H,4-5,8,11-14H2,(H,23,27) |
| InChIKey | CAGARFUMAFZKAL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|