C25H31N3O3 — CID 45229950
N-[3-(3-hydroxypiperidin-1-yl)propyl]-2-(3-phenylpropyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 45229950) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[3-(3-hydroxypiperidin-1-yl)propyl]-2-(3-phenylpropyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-[3-(3-hydroxypiperidin-1-yl)propyl]-2-(3-phenylpropyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 45229950 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-[3-(3-hydroxypiperidin-1-yl)propyl]-2-(3-phenylpropyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC(O)C1)c1ccc2oc(CCCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C25H31N3O3/c29-21-10-5-15-28(18-21)16-6-14-26-25(30)20-12-13-23-22(17-20)27-24(31-23)11-4-9-19-7-2-1-3-8-19/h1-3,7-8,12-13,17,21,29H,4-6,9-11,14-16,18H2,(H,26,30) |
| InChIKey | LYVQFBNDVGHBEM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|