C20H17N5O2S — CID 117088450
N-(2-phenoxyethyl)-2-(pyrimidin-2-ylamino)-1,3-benzothiazole-6-carboxamide (PubChem CID 117088450) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(pyrimidin-2-ylamino)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(2-phenoxyethyl)-2-(pyrimidin-2-ylamino)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 117088450 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(pyrimidin-2-ylamino)-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1ccc2nc(Nc3ncccn3)sc2c1 |
| InChI | InChI=1S/C20H17N5O2S/c26-18(21-11-12-27-15-5-2-1-3-6-15)14-7-8-16-17(13-14)28-20(24-16)25-19-22-9-4-10-23-19/h1-10,13H,11-12H2,(H,21,26)(H,22,23,24,25) |
| InChIKey | YKHDCTRDXPYTGW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|