C25H25N5O2S — CID 117084547
N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzothiazole-6-carboxamide (PubChem CID 117084547) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 117084547 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1ccc2nc(N3CCN(c4ccccn4)CC3)sc2c1 |
| InChI | InChI=1S/C25H25N5O2S/c31-24(27-12-17-32-20-6-2-1-3-7-20)19-9-10-21-22(18-19)33-25(28-21)30-15-13-29(14-16-30)23-8-4-5-11-26-23/h1-11,18H,12-17H2,(H,27,31) |
| InChIKey | DKTHIHJODUZNAU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|