C28H31N5O5 — CID 24789201
3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-[3-(2-oxopyrrolidin-1-yl)propylamino]phenyl]propanamide (PubChem CID 24789201) has the molecular formula C28H31N5O5 and a molecular weight of 517.59 g/mol. Its IUPAC name is 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-[3-(2-oxopyrrolidin-1-yl)propylamino]phenyl]propanamide.
| Compound Name | 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-[3-(2-oxopyrrolidin-1-yl)propylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 24789201 |
| Molecular Formula | C28H31N5O5 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-[3-(2-oxopyrrolidin-1-yl)propylamino]phenyl]propanamide |
| SMILES | NC(=O)CC(NC(=O)Cc1cccc2ccccc12)c1ccc(NCCCN2CCCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H31N5O5/c29-26(34)18-24(31-27(35)17-20-8-3-7-19-6-1-2-9-22(19)20)21-11-12-23(25(16-21)33(37)38)30-13-5-15-32-14-4-10-28(32)36/h1-3,6-9,11-12,16,24,30H,4-5,10,13-15,17-18H2,(H2,29,34)(H,31,35) |
| InChIKey | LBHVYPVROHZZIC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|