C27H25N5O4 — CID 16746235
3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-(pyridin-2-ylmethylamino)phenyl]propanamide (PubChem CID 16746235) has the molecular formula C27H25N5O4 and a molecular weight of 483.53 g/mol. Its IUPAC name is 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-(pyridin-2-ylmethylamino)phenyl]propanamide.
| Compound Name | 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-(pyridin-2-ylmethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 16746235 |
| Molecular Formula | C27H25N5O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-[(2-naphthalen-1-ylacetyl)amino]-3-[3-nitro-4-(pyridin-2-ylmethylamino)phenyl]propanamide |
| SMILES | NC(=O)CC(NC(=O)Cc1cccc2ccccc12)c1ccc(NCc2ccccn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H25N5O4/c28-26(33)16-24(31-27(34)15-19-8-5-7-18-6-1-2-10-22(18)19)20-11-12-23(25(14-20)32(35)36)30-17-21-9-3-4-13-29-21/h1-14,24,30H,15-17H2,(H2,28,33)(H,31,34) |
| InChIKey | UDOXRFYLEIYVNO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|